CAS 1510495-71-2 is the registry number for 1-Bromo-4-(1,1,1-trifluoropropan-2-yl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-4-(1,1,1-trifluoropropan-2-yl)benzene (CAS 1510495-71-2) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 1-bromo-4-(1,1,1-trifluoropropan-2-yl)benzene. InChIKey: NSGZGNHASNAVRH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 1-bromo-4-(1,1,1-trifluoropropan-2-yl)benzene |
| InChIKey | NSGZGNHASNAVRH-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)