CAS 1099660-62-4 is the registry number for Methyl 3,5-dichloro-2-sulfamoylbenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 3,5-dichloro-2-sulfamoylbenzoate (CAS 1099660-62-4) is a chemical compound with the molecular formula C8H7Cl2NO4S and a molecular weight of 284.12 g/mol. IUPAC name: methyl 3,5-dichloro-2-sulfamoylbenzoate. InChIKey: GPRNWKNXIFHGTN-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO4S |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | methyl 3,5-dichloro-2-sulfamoylbenzoate |
| InChIKey | GPRNWKNXIFHGTN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)