Products 5046-15-1
CAS 5046-15-1 appears in our catalog under these names: Methyl 5-(aminosulfonyl)-2,4-dichlorobenzoate, 95%, Methyl 2,4-dichloro-5-sulfamoylbenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
Methyl 2,4-dichloro-5-sulfamoylbenzoate (CAS 5046-15-1) is a chemical compound with the molecular formula C8H7Cl2NO4S and a molecular weight of 284.12 g/mol. IUPAC name: methyl 2,4-dichloro-5-sulfamoylbenzoate. InChIKey: ZXSGVNRCYQXHNK-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO4S |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | methyl 2,4-dichloro-5-sulfamoylbenzoate |
| InChIKey | ZXSGVNRCYQXHNK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)