CAS 1599787-03-7 is the registry number for Methyl N-(2-chloro-4-(chlorosulfonyl)phenyl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl N-(2-chloro-4-chlorosulfonylphenyl)carbamate (CAS 1599787-03-7) is a chemical compound with the molecular formula C8H7Cl2NO4S and a molecular weight of 284.12 g/mol. IUPAC name: methyl N-(2-chloro-4-chlorosulfonylphenyl)carbamate. InChIKey: SAMAJGYEQIWDDI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO4S |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | methyl N-(2-chloro-4-chlorosulfonylphenyl)carbamate |
| InChIKey | SAMAJGYEQIWDDI-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=C(C=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)