Products 4847-36-3

CAS 4847-36-3 appears in our catalog under these names: 2,4-Dichloro-5-(methylsulfamoyl)benzoic acid, 95%, 2,4-Dichloro-5-(methylsulfamoyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

2,4-dichloro-5-(methylsulfamoyl)benzoic acid (CAS 4847-36-3) is a chemical compound with the molecular formula C8H7Cl2NO4S and a molecular weight of 284.12 g/mol. IUPAC name: 2,4-dichloro-5-(methylsulfamoyl)benzoic acid. InChIKey: ANXVCANQKDPGAH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7Cl2NO4S
Molecular weight284.12 g/mol
IUPAC name2,4-dichloro-5-(methylsulfamoyl)benzoic acid
InChIKeyANXVCANQKDPGAH-UHFFFAOYSA-N
SMILESCNS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)