CAS 129582-99-6 appears in our catalog under these names: (3,4-Dichloro-benzenesulfonylamino)-acetic acid, 95%, 2-(3,4-Dichlorobenzenesulfonamido)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[(3,4-dichlorophenyl)sulfonylamino]acetic acid (CAS 129582-99-6) is a chemical compound with the molecular formula C8H7Cl2NO4S and a molecular weight of 284.12 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)sulfonylamino]acetic acid. InChIKey: APIPQJHUNCPKSU-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO4S |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenyl)sulfonylamino]acetic acid |
| InChIKey | APIPQJHUNCPKSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)NCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)