CAS 716360-56-4 appears in our catalog under these names: 2,6-Dichloro-3-(methylsulfamoyl)benzoic acid, 95%, 2,6-Dichloro-3-(methylsulfamoyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2,6-dichloro-3-(methylsulfamoyl)benzoic acid (CAS 716360-56-4) is a chemical compound with the molecular formula C8H7Cl2NO4S and a molecular weight of 284.12 g/mol. IUPAC name: 2,6-dichloro-3-(methylsulfamoyl)benzoic acid. InChIKey: XXVVPZSSECZKLO-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO4S |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | 2,6-dichloro-3-(methylsulfamoyl)benzoic acid |
| InChIKey | XXVVPZSSECZKLO-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(C(=C(C=C1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)