CAS 1492443-73-8 is the registry number for 3-Carbamoyl-5-chloro-2-methoxybenzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-carbamoyl-5-chloro-2-methoxybenzenesulfonyl chloride (CAS 1492443-73-8) is a chemical compound with the molecular formula C8H7Cl2NO4S and a molecular weight of 284.12 g/mol. IUPAC name: 3-carbamoyl-5-chloro-2-methoxybenzenesulfonyl chloride. InChIKey: ZOKBWYGGUUFUNE-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO4S |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | 3-carbamoyl-5-chloro-2-methoxybenzenesulfonyl chloride |
| InChIKey | ZOKBWYGGUUFUNE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1S(=O)(=O)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)