CAS 110144-22-4 appears in our catalog under these names: 1,4-Bis((E)-2-(pyridin-4-yl)vinyl)benzene, 97%, 97%, 1,4-Bis((E)-2-(pyridin-4-yl)vinyl)benzene, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[(E)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine (CAS 110144-22-4) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: 4-[(E)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine. InChIKey: QRZWEROLVZUPJH-KQQUZDAGSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 4-[(E)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine |
| InChIKey | QRZWEROLVZUPJH-KQQUZDAGSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=NC=C2)/C=C/C3=CC=NC=C3 |
Computed by PubChem (NCBI)