Products 110144-24-6

CAS 110144-24-6 is the registry number for Methyl 6-acetylpyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 6-acetylpyridine-2-carboxylate (CAS 110144-24-6) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 6-acetylpyridine-2-carboxylate. InChIKey: DFCHNHGPZHQYRP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO3
Molecular weight179.17 g/mol
IUPAC namemethyl 6-acetylpyridine-2-carboxylate
InChIKeyDFCHNHGPZHQYRP-UHFFFAOYSA-N
SMILESCC(=O)C1=NC(=CC=C1)C(=O)OC

Computed by PubChem (NCBI)