CAS 110144-24-6 is the registry number for Methyl 6-acetylpyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 6-acetylpyridine-2-carboxylate (CAS 110144-24-6) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 6-acetylpyridine-2-carboxylate. InChIKey: DFCHNHGPZHQYRP-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 6-acetylpyridine-2-carboxylate |
| InChIKey | DFCHNHGPZHQYRP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC(=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)