Products 1103894-71-8
CAS 1103894-71-8 appears in our catalog under these names: 2-(Trifluoromethoxy)-L-phenylalanine, 97%, H-L-Phe(2-OCF3)-OH. Offered by: AmBeed, Iris Biotech. Available pack sizes: 1g, 50mg, 250mg.
(2S)-2-amino-3-[2-(trifluoromethoxy)phenyl]propanoic acid (CAS 1103894-71-8) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: (2S)-2-amino-3-[2-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: ILPKLBNKYRAICX-ZETCQYMHSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | (2S)-2-amino-3-[2-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | ILPKLBNKYRAICX-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)N)OC(F)(F)F |
Computed by PubChem (NCBI)