Products 1104386-44-8

CAS 1104386-44-8 is the registry number for 2,4-difluoro-6-methoxybenzoic acid, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

2,4-difluoro-6-methoxybenzoic acid, ≥97%, ≥97%
Chemat
  • size: 100mg, 250mg, 1g
  • Variants: 3
from 1010.00
View product
Structural formula: {0} (CAS {1})

2,4-difluoro-6-methoxybenzoic acid (CAS 1104386-44-8) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,4-difluoro-6-methoxybenzoic acid. InChIKey: QLROVWLINOPNSG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O3
Molecular weight188.13 g/mol
IUPAC name2,4-difluoro-6-methoxybenzoic acid
InChIKeyQLROVWLINOPNSG-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)F)F)C(=O)O

Computed by PubChem (NCBI)

Synonyms: 2,4-Difluoro-6-methoxybenzoic acid
Isomers (same molecular formula)
methyl 3,6-difluoro-2-hydroxybenzoate C8H6F2O3
4,4-difluoro-1-(furan-2-yl)butane-1,3-dione C8H6F2O3
methyl 2,4-difluoro-3-hydroxybenzoate C8H6F2O3
methyl 2,6-difluoro-4-hydroxybenzoate C8H6F2O3
methyl 2,3-difluoro-4-hydroxybenzoate C8H6F2O3
2,4-difluoro-3-methoxybenzoic acid C8H6F2O3
3,5-difluoro-2-methoxybenzoic acid C8H6F2O3
(2,2-difluoro-1,3-benzodioxol-5-yl)methanol C8H6F2O3
3,6-difluoro-2-methoxybenzoic acid C8H6F2O3
2,3-difluoro-4-methoxybenzoic acid C8H6F2O3
3,4-difluoro-5-methoxybenzoic acid C8H6F2O3
methyl 2,6-difluoro-3-hydroxybenzoate C8H6F2O3