Products 1105193-50-7
CAS 1105193-50-7 appears in our catalog under these names: 5-(Naphthalen-1-yl)isoxazole-3-carboxylic acid, 95%, 95%, 5-(1-naphthyl)isoxazole-3-carboxylic acid, 95%, 5-(Naphthalen-1-yl)isoxazole-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-naphthalen-1-yl-1,2-oxazole-3-carboxylic acid (CAS 1105193-50-7) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 5-naphthalen-1-yl-1,2-oxazole-3-carboxylic acid. InChIKey: AUIITIJVBCOPRF-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 5-naphthalen-1-yl-1,2-oxazole-3-carboxylic acid |
| InChIKey | AUIITIJVBCOPRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC(=NO3)C(=O)O |
Computed by PubChem (NCBI)