Products 1105985-15-6
CAS 1105985-15-6 appears in our catalog under these names: 2-Chloro-6-(difluoromethyl)nicotinic acid, 95%, 2-Chloro-6-(difluoromethyl)nicotinic acid, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
2-chloro-6-(difluoromethyl)pyridine-3-carboxylic acid (CAS 1105985-15-6) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 2-chloro-6-(difluoromethyl)pyridine-3-carboxylic acid. InChIKey: WKZVVMZDNPKOOW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 2-chloro-6-(difluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | WKZVVMZDNPKOOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)Cl)C(F)F |
Computed by PubChem (NCBI)