Products 1106917-71-8
CAS 1106917-71-8 appears in our catalog under these names: [3-(Difluoromethoxy)phenyl]methanamine hydrochloride, 95%, 1-(3-(Difluoromethoxy)phenyl)methanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
[3-(difluoromethoxy)phenyl]methanamine;hydrochloride (CAS 1106917-71-8) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: [3-(difluoromethoxy)phenyl]methanamine;hydrochloride. InChIKey: DTGHRIRRKQGREU-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | [3-(difluoromethoxy)phenyl]methanamine;hydrochloride |
| InChIKey | DTGHRIRRKQGREU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)CN.Cl |
Computed by PubChem (NCBI)