Products 1431962-99-0
CAS 1431962-99-0 is the registry number for 2-(Difluoromethoxy)-4-methylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 5g.
2-(difluoromethoxy)-4-methylaniline;hydrochloride (CAS 1431962-99-0) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: 2-(difluoromethoxy)-4-methylaniline;hydrochloride. InChIKey: BQEMDYFBTKCASQ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | 2-(difluoromethoxy)-4-methylaniline;hydrochloride |
| InChIKey | BQEMDYFBTKCASQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)OC(F)F.Cl |
Computed by PubChem (NCBI)