Products 1193389-89-7
CAS 1193389-89-7 is the registry number for 2-Amino-2-(2,5-difluorophenyl)ethan-1-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-2-(2,5-difluorophenyl)ethanol;hydrochloride (CAS 1193389-89-7) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: 2-amino-2-(2,5-difluorophenyl)ethanol;hydrochloride. InChIKey: ZSITZKWTMIGQEY-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | 2-amino-2-(2,5-difluorophenyl)ethanol;hydrochloride |
| InChIKey | ZSITZKWTMIGQEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(CO)N)F.Cl |
Computed by PubChem (NCBI)