CAS 1956434-83-5 appears in our catalog under these names: (R)-2-Amino-2-(3,5-difluorophenyl)ethanol hydrochloride, 95%, (R)–2–Amino–2–(3,5–difluorophenyl)ethanol hydrochloride, (R)-2-Amino-2-(3,5-difluorophenyl)ethanol hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2R)-2-amino-2-(3,5-difluorophenyl)ethanol;hydrochloride (CAS 1956434-83-5) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: (2R)-2-amino-2-(3,5-difluorophenyl)ethanol;hydrochloride. InChIKey: NFBOQSJNFZSBBC-QRPNPIFTSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | (2R)-2-amino-2-(3,5-difluorophenyl)ethanol;hydrochloride |
| InChIKey | NFBOQSJNFZSBBC-QRPNPIFTSA-N |
| SMILES | C1=C(C=C(C=C1F)F)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)