Products 1956436-65-9
CAS 1956436-65-9 appears in our catalog under these names: (2R)-2-Amino-2-(2,5-difluorophenyl)ethan-1-ol hydrochloride, 95%, (R)–2–Amino–2–(2，5–difluorophenyl)ethanol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2R)-2-amino-2-(2,5-difluorophenyl)ethanol;hydrochloride (CAS 1956436-65-9) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: (2R)-2-amino-2-(2,5-difluorophenyl)ethanol;hydrochloride. InChIKey: ZSITZKWTMIGQEY-QRPNPIFTSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | (2R)-2-amino-2-(2,5-difluorophenyl)ethanol;hydrochloride |
| InChIKey | ZSITZKWTMIGQEY-QRPNPIFTSA-N |
| SMILES | C1=CC(=C(C=C1F)[C@H](CO)N)F.Cl |
Computed by PubChem (NCBI)