Products 1989672-90-3
CAS 1989672-90-3 appears in our catalog under these names: 2-Amino-2-(2,4-difluorophenyl)ethan-1-ol hydrochloride, 95%, 2-amino-2-(2,4-difluorophenyl)ethan-1-ol hydrochloride, 2-Amino-2-(2,4-difluorophenyl)ethan-1-ol hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2-amino-2-(2,4-difluorophenyl)ethanol;hydrochloride (CAS 1989672-90-3) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: 2-amino-2-(2,4-difluorophenyl)ethanol;hydrochloride. InChIKey: OWOSOCQHBOENHK-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | 2-amino-2-(2,4-difluorophenyl)ethanol;hydrochloride |
| InChIKey | OWOSOCQHBOENHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(CO)N.Cl |
Computed by PubChem (NCBI)