Products 1423029-39-3
CAS 1423029-39-3 appears in our catalog under these names: 3-Ethoxy-2,6-difluoroaniline hydrochloride, 3-Ethoxy-2,6-difluoroaniline hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-ethoxy-2,6-difluoroaniline;hydrochloride (CAS 1423029-39-3) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: 3-ethoxy-2,6-difluoroaniline;hydrochloride. InChIKey: TZOIKURYPPBJSP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | 3-ethoxy-2,6-difluoroaniline;hydrochloride |
| InChIKey | TZOIKURYPPBJSP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)F)N)F.Cl |
Computed by PubChem (NCBI)