Products 1107620-67-6
CAS 1107620-67-6 is the registry number for Garcinexanthone A. Offered by: MedChemExpress. Available pack sizes: Get quote.
7,10-dihydroxy-12-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one (CAS 1107620-67-6) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 7,10-dihydroxy-12-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one. InChIKey: AWSPLWUUTQJIOF-UHFFFAOYSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 7,10-dihydroxy-12-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one |
| InChIKey | AWSPLWUUTQJIOF-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=CC3=C(C(=C2O1)OC)OC4=C(C=CC(=C4C3=O)O)O)C |
Computed by PubChem (NCBI)