CAS 110861-18-2 is the registry number for Acetic acid 5,6-dichloro-pyridin-3-yl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5,6-dichloro-3-pyridinyl) acetate (CAS 110861-18-2) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: (5,6-dichloro-3-pyridinyl) acetate. InChIKey: ZWUBSOYJEJHMRR-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | (5,6-dichloro-3-pyridinyl) acetate |
| InChIKey | ZWUBSOYJEJHMRR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(N=C1)Cl)Cl |
Computed by PubChem (NCBI)