Products 1108726-74-4
CAS 1108726-74-4 appears in our catalog under these names: 5–(1H–Pyrazol–4–yl)isophthalic acid, 5-(1H-Pyrazol-4-yl)isophthalic acid, 98%, 5-(1H-Pyrazol-4-yl)isophthalic acid, 97%. Offered by: GLPBio, Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxylic acid (CAS 1108726-74-4) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxylic acid. InChIKey: PPAVNVRCVCVWOF-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 5-(1H-pyrazol-4-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | PPAVNVRCVCVWOF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C2=CNN=C2 |
Computed by PubChem (NCBI)