CAS 1113025-24-3 is the registry number for (1S,2S,4R)-2-(Hydroxymethyl)-4-(tritylamino)cyclopentan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S,4R)-2-(hydroxymethyl)-4-(tritylamino)cyclopentan-1-ol (CAS 1113025-24-3) is a chemical compound with the molecular formula C25H27NO2 and a molecular weight of 373.5 g/mol. IUPAC name: (1S,2S,4R)-2-(hydroxymethyl)-4-(tritylamino)cyclopentan-1-ol. InChIKey: OIHMNCYDYHEXKE-IEXUWNMDSA-N.
| Molecular formula | C25H27NO2 |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | (1S,2S,4R)-2-(hydroxymethyl)-4-(tritylamino)cyclopentan-1-ol |
| InChIKey | OIHMNCYDYHEXKE-IEXUWNMDSA-N |
| SMILES | C1[C@H](C[C@@H]([C@@H]1CO)O)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)