CAS 83647-33-0 appears in our catalog under these names: N-Desmethyl Droloxifene (contains up to 5% Z isomer), K-106. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, Get quote.
3-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (CAS 83647-33-0) is a chemical compound with the molecular formula C25H27NO2 and a molecular weight of 373.5 g/mol. IUPAC name: 3-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: QPHNKIXIKDPNDI-OCOZRVBESA-N.
| Molecular formula | C25H27NO2 |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | 3-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | QPHNKIXIKDPNDI-OCOZRVBESA-N |
| SMILES | CC/C(=C(/C1=CC=C(C=C1)OCCNC)\C2=CC(=CC=C2)O)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)