CAS 2188204-80-8 is the registry number for LightOx17, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[4-[2-(4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinolin-6-yl)ethynyl]phenyl]prop-2-enoic acid (CAS 2188204-80-8) is a chemical compound with the molecular formula C25H27NO2 and a molecular weight of 373.5 g/mol. IUPAC name: (E)-3-[4-[2-(4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinolin-6-yl)ethynyl]phenyl]prop-2-enoic acid. InChIKey: BSLSUZAOTWTTLD-WYMLVPIESA-N.
| Molecular formula | C25H27NO2 |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | (E)-3-[4-[2-(4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinolin-6-yl)ethynyl]phenyl]prop-2-enoic acid |
| InChIKey | BSLSUZAOTWTTLD-WYMLVPIESA-N |
| SMILES | CC(C)N1CCC(C2=C1C=CC(=C2)C#CC3=CC=C(C=C3)/C=C/C(=O)O)(C)C |
Computed by PubChem (NCBI)