CAS 1185241-63-7 is the registry number for N-Desmethyl Droloxifene-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
3-[(E)-3,3,4,4,4-pentadeuterio-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (CAS 1185241-63-7) is a chemical compound with the molecular formula C25H27NO2 and a molecular weight of 378.5 g/mol. IUPAC name: 3-[(E)-3,3,4,4,4-pentadeuterio-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: QPHNKIXIKDPNDI-JFIRTRMYSA-N.
| Molecular formula | C25H27NO2 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | 3-[(E)-3,3,4,4,4-pentadeuterio-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | QPHNKIXIKDPNDI-JFIRTRMYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C(=C(/C1=CC=C(C=C1)OCCNC)\C2=CC(=CC=C2)O)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)