CAS 114828-90-9 appears in our catalog under these names: (E)-4-Hydroxy-N-desmethyl Tamoxifen, >95% (HPLC), Endoxifen (E-isomer)/ 98.31% (existing batch purity), Endoxifen (E-isomer), 98.02%. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
4-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol (CAS 114828-90-9) is a chemical compound with the molecular formula C25H27NO2 and a molecular weight of 373.5 g/mol. IUPAC name: 4-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: MHJBZVSGOZTKRH-OCOZRVBESA-N.
| Molecular formula | C25H27NO2 |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | 4-[(E)-1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | MHJBZVSGOZTKRH-OCOZRVBESA-N |
| SMILES | CC/C(=C(/C1=CC=C(C=C1)O)\C2=CC=C(C=C2)OCCNC)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)