CAS 170171-12-7 is the registry number for N-Desmethyl-4’-hydroxy Tamoxifen, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 25mg, 5mg.
4-[(Z)-1-[4-[2-(methylamino)ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol (CAS 170171-12-7) is a chemical compound with the molecular formula C25H27NO2 and a molecular weight of 373.5 g/mol. IUPAC name: 4-[(Z)-1-[4-[2-(methylamino)ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol. InChIKey: KLPBCGLMGLFHNY-IZHYLOQSSA-N.
| Molecular formula | C25H27NO2 |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | 4-[(Z)-1-[4-[2-(methylamino)ethoxy]phenyl]-1-phenylbut-1-en-2-yl]phenol |
| InChIKey | KLPBCGLMGLFHNY-IZHYLOQSSA-N |
| SMILES | CC/C(=C(\C1=CC=CC=C1)/C2=CC=C(C=C2)OCCNC)/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)