Products 1795139-22-8
CAS 1795139-22-8 appears in our catalog under these names: N-Desmethyl-4'-hydroxy Tamoxifen-d3 (E/Z Mixture), N-Desmethyl-4’-hydroxy Tamoxifen-d3 (E/Z Mixture). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4-[(Z)-1-phenyl-1-[4-[2-(trideuteriomethylamino)ethoxy]phenyl]but-1-en-2-yl]phenol (CAS 1795139-22-8) is a chemical compound with the molecular formula C25H27NO2 and a molecular weight of 376.5 g/mol. IUPAC name: 4-[(Z)-1-phenyl-1-[4-[2-(trideuteriomethylamino)ethoxy]phenyl]but-1-en-2-yl]phenol. InChIKey: KLPBCGLMGLFHNY-CANUYGMUSA-N.
| Molecular formula | C25H27NO2 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | 4-[(Z)-1-phenyl-1-[4-[2-(trideuteriomethylamino)ethoxy]phenyl]but-1-en-2-yl]phenol |
| InChIKey | KLPBCGLMGLFHNY-CANUYGMUSA-N |
| SMILES | [2H]C([2H])([2H])NCCOC1=CC=C(C=C1)/C(=C(/CC)\C2=CC=C(C=C2)O)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)