CAS 111310-59-9 appears in our catalog under these names: 5-Chloro-1,3-dihydrobenzo(c)isothiazole 2,2-dioxide, 95%, 5-​Chloro-​1,​3-​dihydro-​2,​1-​benzisothiazole 2,​2-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-1,3-dihydro-2,1-benzothiazole 2,2-dioxide (CAS 111310-59-9) is a chemical compound with the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. IUPAC name: 5-chloro-1,3-dihydro-2,1-benzothiazole 2,2-dioxide. InChIKey: ZOQPCTNXWYKEAN-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2S |
|---|---|
| Molecular weight | 203.65 g/mol |
| IUPAC name | 5-chloro-1,3-dihydro-2,1-benzothiazole 2,2-dioxide |
| InChIKey | ZOQPCTNXWYKEAN-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Cl)NS1(=O)=O |
Computed by PubChem (NCBI)