CAS 1184743-95-0 is the registry number for 5-Chloro-6-(methylsulfanyl)pyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-chloro-6-methylsulfanylpyridine-3-carboxylic acid (CAS 1184743-95-0) is a chemical compound with the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. IUPAC name: 5-chloro-6-methylsulfanylpyridine-3-carboxylic acid. InChIKey: OUJCEVZWCQMIPU-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2S |
|---|---|
| Molecular weight | 203.65 g/mol |
| IUPAC name | 5-chloro-6-methylsulfanylpyridine-3-carboxylic acid |
| InChIKey | OUJCEVZWCQMIPU-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)