CAS 1934452-09-1 is the registry number for 4-Chloro-2-cyclopropylthiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2-cyclopropyl-1,3-thiazole-5-carboxylic acid (CAS 1934452-09-1) is a chemical compound with the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. IUPAC name: 4-chloro-2-cyclopropyl-1,3-thiazole-5-carboxylic acid. InChIKey: DFNFYFSBWKQQPY-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2S |
|---|---|
| Molecular weight | 203.65 g/mol |
| IUPAC name | 4-chloro-2-cyclopropyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | DFNFYFSBWKQQPY-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)