CAS 2515-75-5 appears in our catalog under these names: 5-Chloro-2,3-dihydrobenzo(d)isothiazole 1,1-dioxide, 95%, 5-​Chloro-​2,​3-​dihydro-​1,​2-​benzisothiazole 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
5-chloro-2,3-dihydro-1,2-benzothiazole 1,1-dioxide (CAS 2515-75-5) is a chemical compound with the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1,2-benzothiazole 1,1-dioxide. InChIKey: JHBBXDBLGMVVBK-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2S |
|---|---|
| Molecular weight | 203.65 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1,2-benzothiazole 1,1-dioxide |
| InChIKey | JHBBXDBLGMVVBK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Cl)S(=O)(=O)N1 |
Computed by PubChem (NCBI)