Products 1596116-38-9

CAS 1596116-38-9 is the registry number for 5-Chloro-2-(methylthio)isonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-chloro-2-methylsulfanylpyridine-4-carboxylic acid (CAS 1596116-38-9) is a chemical compound with the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. IUPAC name: 5-chloro-2-methylsulfanylpyridine-4-carboxylic acid. InChIKey: DWKGIQPNUCYICT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO2S
Molecular weight203.65 g/mol
IUPAC name5-chloro-2-methylsulfanylpyridine-4-carboxylic acid
InChIKeyDWKGIQPNUCYICT-UHFFFAOYSA-N
SMILESCSC1=NC=C(C(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)