CAS 1183628-42-3 is the registry number for 3-Chloro-6-(methylthio)picolinic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-chloro-6-methylsulfanylpyridine-2-carboxylic acid (CAS 1183628-42-3) is a chemical compound with the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. IUPAC name: 3-chloro-6-methylsulfanylpyridine-2-carboxylic acid. InChIKey: KCNDVIJSOUSNTB-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2S |
|---|---|
| Molecular weight | 203.65 g/mol |
| IUPAC name | 3-chloro-6-methylsulfanylpyridine-2-carboxylic acid |
| InChIKey | KCNDVIJSOUSNTB-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)