Products 1783543-40-7
CAS 1783543-40-7 is the registry number for 2-Chloro-5-cyclopropylthiazole-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-cyclopropyl-1,3-thiazole-4-carboxylic acid (CAS 1783543-40-7) is a chemical compound with the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. IUPAC name: 2-chloro-5-cyclopropyl-1,3-thiazole-4-carboxylic acid. InChIKey: VZTPIPAQXSRLFU-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2S |
|---|---|
| Molecular weight | 203.65 g/mol |
| IUPAC name | 2-chloro-5-cyclopropyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | VZTPIPAQXSRLFU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(N=C(S2)Cl)C(=O)O |
Computed by PubChem (NCBI)