CAS 111329-41-0 is the registry number for 4,4'-Methylenebis(2,5-dimethylphenol). Offered by: Biosynth. Available pack sizes: 250g.
4-[(4-hydroxy-2,5-dimethylphenyl)methyl]-2,5-dimethylphenol (CAS 111329-41-0) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 4-[(4-hydroxy-2,5-dimethylphenyl)methyl]-2,5-dimethylphenol. InChIKey: YDSGCMVPVMGPGG-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 4-[(4-hydroxy-2,5-dimethylphenyl)methyl]-2,5-dimethylphenol |
| InChIKey | YDSGCMVPVMGPGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1O)C)CC2=C(C=C(C(=C2)C)O)C |
Computed by PubChem (NCBI)