CAS 111331-82-9 appears in our catalog under these names: Boc–3–Abz–OH, Boc-3-Abz-OH, 3-[(tert-Butoxycarbonyl)amino]benzoic Acid, >98.0%(HPLC)(T), Boc-3-Abz-OH 98%, 3-(BOC-AMINO)BENZOIC ACID. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 1000g, 1g, 10g, 500g, 1kg.
3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 111331-82-9) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: SAPAUOFSCLCQJB-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | SAPAUOFSCLCQJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)