CAS 111342-31-5 is the registry number for 4-Hydroxy Phenobarbital-d5. Offered by: TRC. Available pack sizes: 10mg, 1mg.
5-(4-hydroxyphenyl)-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione (CAS 111342-31-5) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 253.26 g/mol. IUPAC name: 5-(4-hydroxyphenyl)-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione. InChIKey: IEPXMKJNWPXDBP-ZBJDZAJPSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | IEPXMKJNWPXDBP-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(C(=O)NC(=O)NC1=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)