Products 1116339-78-6
CAS 1116339-78-6 is the registry number for 1-(5-Bromo-4-nitroindoline)ethanone, 97%. Offered by: Chemat. Available pack sizes: 1g.
1-(5-bromo-4-nitro-2,3-dihydroindol-1-yl)ethanone (CAS 1116339-78-6) is a chemical compound with the molecular formula C10H9BrN2O3 and a molecular weight of 285.09 g/mol. IUPAC name: 1-(5-bromo-4-nitro-2,3-dihydroindol-1-yl)ethanone. InChIKey: SFJNUMBLZKWIHK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O3 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | 1-(5-bromo-4-nitro-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | SFJNUMBLZKWIHK-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2[N+](=O)[O-])Br |
Computed by PubChem (NCBI)