Products 1119452-69-5
CAS 1119452-69-5 appears in our catalog under these names: 4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-n-methylbenzamide, 95%, 4-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)-N-methylbenzamide 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-methylbenzamide (CAS 1119452-69-5) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-methylbenzamide. InChIKey: UHYKXGIATBITKD-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2 |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-methylbenzamide |
| InChIKey | UHYKXGIATBITKD-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=C(C=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)