CAS 119139-69-4 is the registry number for 2-Chloro-2-(4'-cyanophenylhydrazono)acetic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl (2Z)-2-chloro-2-[(4-cyanophenyl)hydrazinylidene]acetate (CAS 119139-69-4) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: ethyl (2Z)-2-chloro-2-[(4-cyanophenyl)hydrazinylidene]acetate. InChIKey: QHTRFRPQXNGAGZ-GDNBJRDFSA-N.
| Molecular formula | C11H10ClN3O2 |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | ethyl (2Z)-2-chloro-2-[(4-cyanophenyl)hydrazinylidene]acetate |
| InChIKey | QHTRFRPQXNGAGZ-GDNBJRDFSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC=C(C=C1)C#N)/Cl |
Computed by PubChem (NCBI)