CAS 1147199-25-4 appears in our catalog under these names: Methyl 1–(4–Chlorophenyl)–5–methyl–1,2,3–triazole–4–carboxylate, Methyl 1-(4-chlorophenyl)-5-methyl-1,2,3-triazole-4-carboxylate, 95%, Methyl 1-(4-Chlorophenyl)-5-methyl-1,2,3-triazole-4-carboxylate, >97%, >97%. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
Methyl 1-(4-chlorophenyl)-5-methyltriazole-4-carboxylate (CAS 1147199-25-4) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: methyl 1-(4-chlorophenyl)-5-methyltriazole-4-carboxylate. InChIKey: MRCVBMFDDZQPPU-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2 |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | methyl 1-(4-chlorophenyl)-5-methyltriazole-4-carboxylate |
| InChIKey | MRCVBMFDDZQPPU-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=C(C=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)