Products 950271-98-4

CAS 950271-98-4 is the registry number for Ethyl 1-(3-chlorophenyl)-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 1-(3-chlorophenyl)triazole-4-carboxylate (CAS 950271-98-4) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: ethyl 1-(3-chlorophenyl)triazole-4-carboxylate. InChIKey: DCROHGQIQVHNQR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClN3O2
Molecular weight251.67 g/mol
IUPAC nameethyl 1-(3-chlorophenyl)triazole-4-carboxylate
InChIKeyDCROHGQIQVHNQR-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN(N=N1)C2=CC(=CC=C2)Cl

Computed by PubChem (NCBI)