CAS 950271-98-4 is the registry number for Ethyl 1-(3-chlorophenyl)-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 1-(3-chlorophenyl)triazole-4-carboxylate (CAS 950271-98-4) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: ethyl 1-(3-chlorophenyl)triazole-4-carboxylate. InChIKey: DCROHGQIQVHNQR-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2 |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | ethyl 1-(3-chlorophenyl)triazole-4-carboxylate |
| InChIKey | DCROHGQIQVHNQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(N=N1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)