CAS 343347-98-8 is the registry number for 6-Amino-1-benzyl-5-chloropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-1-benzyl-5-chloropyrimidine-2,4-dione (CAS 343347-98-8) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: 6-amino-1-benzyl-5-chloropyrimidine-2,4-dione. InChIKey: QRSZFEFKJQUCCN-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2 |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 6-amino-1-benzyl-5-chloropyrimidine-2,4-dione |
| InChIKey | QRSZFEFKJQUCCN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C(C(=O)NC2=O)Cl)N |
Computed by PubChem (NCBI)