CAS 62726-02-7 appears in our catalog under these names: (4-Amino-5-chloro-2-methoxyphenyl)(1H-imidazol-1-yl)methanone, 97%, (4-amino-5-chloro-2-methoxyphenyl)(1H-imidazol-1-yl)methanone. Offered by: Chemat Brand. Available pack sizes: on request.
(4-amino-5-chloro-2-methoxyphenyl)-imidazol-1-ylmethanone (CAS 62726-02-7) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: (4-amino-5-chloro-2-methoxyphenyl)-imidazol-1-ylmethanone. InChIKey: MXVXHFXRDDRSST-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2 |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | (4-amino-5-chloro-2-methoxyphenyl)-imidazol-1-ylmethanone |
| InChIKey | MXVXHFXRDDRSST-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)N2C=CN=C2)Cl)N |
Computed by PubChem (NCBI)