CAS 1597781-28-6 is the registry number for 4-Chloro-2-methyl-5-[(6-methylpyridin-3-yl)oxy]-2,3-dihydropyridazin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-chloro-2-methyl-5-[(6-methyl-3-pyridinyl)oxy]pyridazin-3-one (CAS 1597781-28-6) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: 4-chloro-2-methyl-5-[(6-methyl-3-pyridinyl)oxy]pyridazin-3-one. InChIKey: MUKTWXROXPDQCH-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2 |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 4-chloro-2-methyl-5-[(6-methyl-3-pyridinyl)oxy]pyridazin-3-one |
| InChIKey | MUKTWXROXPDQCH-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)OC2=C(C(=O)N(N=C2)C)Cl |
Computed by PubChem (NCBI)