CAS 111955-05-6 appears in our catalog under these names: cis–2–Carbomethoxycyclohexane–1–carboxylic acid, cis-2-Carbomethoxycyclohexane-1-carboxylic acid 97%, cis-2-Carbomethoxycyclohexane-1-carboxylic acid, 98%, 98%, cis-2-Carbomethoxycyclohexane-1-carboxylic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
Cis-(1R,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid (CAS 111955-05-6) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: BOVPVRGRPPYECC-RQJHMYQMSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | cis-(1R,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid |
| InChIKey | BOVPVRGRPPYECC-RQJHMYQMSA-N |
| SMILES | COC(=O)[C@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)